CAS 1020252-31-6 is the registry number for N-(((1,3-dioxoindan-2-ylidene)ethyl)amino)-4-pyridylformamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[(E)-1-(1-hydroxy-3-oxoinden-2-yl)ethylideneamino]pyridine-4-carboxamide (CAS 1020252-31-6) is a chemical compound with the molecular formula C17H13N3O3 and a molecular weight of 307.30 g/mol. IUPAC name: N-[(E)-1-(1-hydroxy-3-oxoinden-2-yl)ethylideneamino]pyridine-4-carboxamide. InChIKey: YSOWLXINFVBCME-VXLYETTFSA-N.
| Molecular formula | C17H13N3O3 |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | N-[(E)-1-(1-hydroxy-3-oxoinden-2-yl)ethylideneamino]pyridine-4-carboxamide |
| InChIKey | YSOWLXINFVBCME-VXLYETTFSA-N |
| SMILES | C/C(=N\NC(=O)C1=CC=NC=C1)/C2=C(C3=CC=CC=C3C2=O)O |
Computed by PubChem (NCBI)