Products 2319609-67-9
CAS 2319609-67-9 is the registry number for KY19334. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-methoxy-3-(3-nitroso-1H-indol-2-yl)-1H-indol-2-ol (CAS 2319609-67-9) is a chemical compound with the molecular formula C17H13N3O3 and a molecular weight of 307.30 g/mol. IUPAC name: 5-methoxy-3-(3-nitroso-1H-indol-2-yl)-1H-indol-2-ol. InChIKey: NNFVURTYXFYQFZ-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O3 |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | 5-methoxy-3-(3-nitroso-1H-indol-2-yl)-1H-indol-2-ol |
| InChIKey | NNFVURTYXFYQFZ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=C2C3=C(C4=CC=CC=C4N3)N=O)O |
Computed by PubChem (NCBI)