Products 204010-55-9
CAS 204010-55-9 is the registry number for AG-1801, 99.88%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 1 mg, 25 mg, 5 mg, 10 mg.
(E)-N-benzyl-2-cyano-3-(4-nitrophenyl)prop-2-enamide (CAS 204010-55-9) is a chemical compound with the molecular formula C17H13N3O3 and a molecular weight of 307.30 g/mol. IUPAC name: (E)-N-benzyl-2-cyano-3-(4-nitrophenyl)prop-2-enamide. InChIKey: GBMZRAHROINDEX-XNTDXEJSSA-N.
| Molecular formula | C17H13N3O3 |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | (E)-N-benzyl-2-cyano-3-(4-nitrophenyl)prop-2-enamide |
| InChIKey | GBMZRAHROINDEX-XNTDXEJSSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)/C(=C/C2=CC=C(C=C2)[N+](=O)[O-])/C#N |
Computed by PubChem (NCBI)