Products 1020253-18-2
CAS 1020253-18-2 is the registry number for 5-Chloro-3-fluoro-2-(pyrrolidin-1-yl)pyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 500g, 5g, 100g, 1g.
5-chloro-3-fluoro-2-pyrrolidin-1-ylpyridine (CAS 1020253-18-2) is a chemical compound with the molecular formula C9H10ClFN2 and a molecular weight of 200.64 g/mol. IUPAC name: 5-chloro-3-fluoro-2-pyrrolidin-1-ylpyridine. InChIKey: IDBIHCGKQNLXJN-UHFFFAOYSA-N.
| Molecular formula | C9H10ClFN2 |
|---|---|
| Molecular weight | 200.64 g/mol |
| IUPAC name | 5-chloro-3-fluoro-2-pyrrolidin-1-ylpyridine |
| InChIKey | IDBIHCGKQNLXJN-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C=C(C=N2)Cl)F |
Computed by PubChem (NCBI)