CAS 2828439-96-7 is the registry number for 3-(1-Aminoethyl)-4-fluorobenzonitrile hydrochloride, 95% HPLC, 95% HPLC. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-(1-aminoethyl)-4-fluorobenzonitrile;hydrochloride (CAS 2828439-96-7) is a chemical compound with the molecular formula C9H10ClFN2 and a molecular weight of 200.64 g/mol. IUPAC name: 3-(1-aminoethyl)-4-fluorobenzonitrile;hydrochloride. InChIKey: JIBDXYPPAALVOG-UHFFFAOYSA-N.
| Molecular formula | C9H10ClFN2 |
|---|---|
| Molecular weight | 200.64 g/mol |
| IUPAC name | 3-(1-aminoethyl)-4-fluorobenzonitrile;hydrochloride |
| InChIKey | JIBDXYPPAALVOG-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC(=C1)C#N)F)N.Cl |
Computed by PubChem (NCBI)