Products 2802461-28-3

CAS 2802461-28-3 is the registry number for 3-[(1R)-1-aminoethyl]-4-fluoro-benzonitrile,hydrochloride, 95% HPLC, 95% HPLC. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-[(1R)-1-aminoethyl]-4-fluorobenzonitrile;hydrochloride (CAS 2802461-28-3) is a chemical compound with the molecular formula C9H10ClFN2 and a molecular weight of 200.64 g/mol. IUPAC name: 3-[(1R)-1-aminoethyl]-4-fluorobenzonitrile;hydrochloride. InChIKey: JIBDXYPPAALVOG-FYZOBXCZSA-N.

Identity
Molecular formulaC9H10ClFN2
Molecular weight200.64 g/mol
IUPAC name3-[(1R)-1-aminoethyl]-4-fluorobenzonitrile;hydrochloride
InChIKeyJIBDXYPPAALVOG-FYZOBXCZSA-N
SMILESC[C@H](C1=C(C=CC(=C1)C#N)F)N.Cl

Computed by PubChem (NCBI)