CAS 1461706-66-0 appears in our catalog under these names: 4-(1-Aminoethyl)-3-fluorobenzonitrile hydrochloride, 95%, 4–(1–Aminoethyl)–3–fluorobenzonitrile hydrochloride, 4-(1-Aminoethyl)-3-fluorobenzonitrile hydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 50mg.
4-(1-aminoethyl)-3-fluorobenzonitrile;hydrochloride (CAS 1461706-66-0) is a chemical compound with the molecular formula C9H10ClFN2 and a molecular weight of 200.64 g/mol. IUPAC name: 4-(1-aminoethyl)-3-fluorobenzonitrile;hydrochloride. InChIKey: IPHUUNLWRXSURM-UHFFFAOYSA-N.
| Molecular formula | C9H10ClFN2 |
|---|---|
| Molecular weight | 200.64 g/mol |
| IUPAC name | 4-(1-aminoethyl)-3-fluorobenzonitrile;hydrochloride |
| InChIKey | IPHUUNLWRXSURM-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)C#N)F)N.Cl |
Computed by PubChem (NCBI)