CAS 102029-99-2 is the registry number for Bzl-his-ome dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl (2S)-2-(benzylamino)-3-(1H-imidazol-5-yl)propanoate;dihydrochloride (CAS 102029-99-2) is a chemical compound with the molecular formula C14H19Cl2N3O2 and a molecular weight of 332.2 g/mol. IUPAC name: methyl (2S)-2-(benzylamino)-3-(1H-imidazol-5-yl)propanoate;dihydrochloride. InChIKey: CSACUQIXYWWVRO-GXKRWWSZSA-N.
| Molecular formula | C14H19Cl2N3O2 |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | methyl (2S)-2-(benzylamino)-3-(1H-imidazol-5-yl)propanoate;dihydrochloride |
| InChIKey | CSACUQIXYWWVRO-GXKRWWSZSA-N |
| SMILES | COC(=O)[C@H](CC1=CN=CN1)NCC2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)