CAS 2228494-70-8 is the registry number for tert-Butyl 3-(4,6-dichloropyridin-2-yl)piperazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-(4,6-dichloro-2-pyridinyl)piperazine-1-carboxylate (CAS 2228494-70-8) is a chemical compound with the molecular formula C14H19Cl2N3O2 and a molecular weight of 332.2 g/mol. IUPAC name: tert-butyl 3-(4,6-dichloro-2-pyridinyl)piperazine-1-carboxylate. InChIKey: VICOYAUZTRIUDO-UHFFFAOYSA-N.
| Molecular formula | C14H19Cl2N3O2 |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | tert-butyl 3-(4,6-dichloro-2-pyridinyl)piperazine-1-carboxylate |
| InChIKey | VICOYAUZTRIUDO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC(C1)C2=NC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)