CAS 1797881-48-1 appears in our catalog under these names: Bendamustine USP Related Compound D, Bendamustine Impurity 5, Deschloroethyl Bendamustine Hydrochloride, >95% (HPLC), 4-(5-((2-Chloroethyl)amino)-1-methyl-1H-benzo[d]imidazol-2-yl)butanoic acid hydrochloride, 95%, 95%. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 25mg, 5mg, 10mg.
4-[5-(2-chloroethylamino)-1-methylbenzimidazol-2-yl]butanoic acid;hydrochloride (CAS 1797881-48-1) is a chemical compound with the molecular formula C14H19Cl2N3O2 and a molecular weight of 332.2 g/mol. IUPAC name: 4-[5-(2-chloroethylamino)-1-methylbenzimidazol-2-yl]butanoic acid;hydrochloride. InChIKey: OPSTYBKPQZPYBQ-UHFFFAOYSA-N.
| Molecular formula | C14H19Cl2N3O2 |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | 4-[5-(2-chloroethylamino)-1-methylbenzimidazol-2-yl]butanoic acid;hydrochloride |
| InChIKey | OPSTYBKPQZPYBQ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)NCCCl)N=C1CCCC(=O)O.Cl |
Computed by PubChem (NCBI)