CAS 93983-56-3 appears in our catalog under these names: H-His(3-Bzl)-OMe 2HCl 95%, H-His(bzl)-ome dihydrochloride, 95%. Offered by: Ambeed, Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Methyl (2S)-2-amino-3-(1-benzylimidazol-4-yl)propanoate;dihydrochloride (CAS 93983-56-3) is a chemical compound with the molecular formula C14H19Cl2N3O2 and a molecular weight of 332.2 g/mol. IUPAC name: methyl (2S)-2-amino-3-(1-benzylimidazol-4-yl)propanoate;dihydrochloride. InChIKey: ACAJLNMXSIOPSZ-GXKRWWSZSA-N.
| Molecular formula | C14H19Cl2N3O2 |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(1-benzylimidazol-4-yl)propanoate;dihydrochloride |
| InChIKey | ACAJLNMXSIOPSZ-GXKRWWSZSA-N |
| SMILES | COC(=O)[C@H](CC1=CN(C=N1)CC2=CC=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)