CAS 102044-68-8 is the registry number for (2R,6R,7R)-7-Amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,6R,7R)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid (CAS 102044-68-8) is a chemical compound with the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. IUPAC name: (2R,6R,7R)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid. InChIKey: PDTVGZMBPPXMAO-ZMIZWQJLSA-N.
| Molecular formula | C7H8N2O3S |
|---|---|
| Molecular weight | 200.22 g/mol |
| IUPAC name | (2R,6R,7R)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid |
| InChIKey | PDTVGZMBPPXMAO-ZMIZWQJLSA-N |
| SMILES | C1=CS[C@@H]2[C@@H](C(=O)N2[C@H]1C(=O)O)N |
Computed by PubChem (NCBI)