Products 1020701-51-2
CAS 1020701-51-2 is the registry number for N-(2-(5-Methoxy-1-tosyl-1H-indol-3-yl)ethyl)acetamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
N-[2-[5-methoxy-1-(4-methylphenyl)sulfonylindol-3-yl]ethyl]acetamide (CAS 1020701-51-2) is a chemical compound with the molecular formula C20H22N2O4S and a molecular weight of 386.5 g/mol. IUPAC name: N-[2-[5-methoxy-1-(4-methylphenyl)sulfonylindol-3-yl]ethyl]acetamide. InChIKey: NKPYOTAGXZEJAT-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O4S |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | N-[2-[5-methoxy-1-(4-methylphenyl)sulfonylindol-3-yl]ethyl]acetamide |
| InChIKey | NKPYOTAGXZEJAT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=C2C=CC(=C3)OC)CCNC(=O)C |
Computed by PubChem (NCBI)