Products 3033288-68-2
CAS 3033288-68-2 appears in our catalog under these names: TRIM24/BRPF1-IN-2, TRIM24/BRPF1-IN-2, 98.74%. Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
N-(1-acetyl-2,3-dihydroindol-5-yl)-5-cyclopropyl-2-methoxybenzenesulfonamide (CAS 3033288-68-2) is a chemical compound with the molecular formula C20H22N2O4S and a molecular weight of 386.5 g/mol. IUPAC name: N-(1-acetyl-2,3-dihydroindol-5-yl)-5-cyclopropyl-2-methoxybenzenesulfonamide. InChIKey: GUDHFUSYMUTOKE-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O4S |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | N-(1-acetyl-2,3-dihydroindol-5-yl)-5-cyclopropyl-2-methoxybenzenesulfonamide |
| InChIKey | GUDHFUSYMUTOKE-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C1C=CC(=C2)NS(=O)(=O)C3=C(C=CC(=C3)C4CC4)OC |
Computed by PubChem (NCBI)