Products 110871-16-4
CAS 110871-16-4 is the registry number for Phelorphan. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-3-phenyl-2-[[(2S)-3-phenyl-2-[(2-sulfanylacetyl)amino]propanoyl]amino]propanoic acid (CAS 110871-16-4) is a chemical compound with the molecular formula C20H22N2O4S and a molecular weight of 386.5 g/mol. IUPAC name: (2S)-3-phenyl-2-[[(2S)-3-phenyl-2-[(2-sulfanylacetyl)amino]propanoyl]amino]propanoic acid. InChIKey: DPRJEBOTAKMRQV-IRXDYDNUSA-N.
| Molecular formula | C20H22N2O4S |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | (2S)-3-phenyl-2-[[(2S)-3-phenyl-2-[(2-sulfanylacetyl)amino]propanoyl]amino]propanoic acid |
| InChIKey | DPRJEBOTAKMRQV-IRXDYDNUSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O)NC(=O)CS |
Computed by PubChem (NCBI)