CAS 120004-07-1 is the registry number for S-312. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 6-methyl-3-(2-methylpropyl)-4-(3-nitrophenyl)-4,7-dihydrothieno[2,3-b]pyridine-5-carboxylate (CAS 120004-07-1) is a chemical compound with the molecular formula C20H22N2O4S and a molecular weight of 386.5 g/mol. IUPAC name: methyl 6-methyl-3-(2-methylpropyl)-4-(3-nitrophenyl)-4,7-dihydrothieno[2,3-b]pyridine-5-carboxylate. InChIKey: UTLPUICHKZBRCI-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O4S |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | methyl 6-methyl-3-(2-methylpropyl)-4-(3-nitrophenyl)-4,7-dihydrothieno[2,3-b]pyridine-5-carboxylate |
| InChIKey | UTLPUICHKZBRCI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C2=C(N1)SC=C2CC(C)C)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)