CAS 1020719-25-8 appears in our catalog under these names: Carvedilol-d3, >95% (HPLC), Carvedilol-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
1-(9H-carbazol-4-yloxy)-3-[2-[2-(trideuteriomethoxy)phenoxy]ethylamino]propan-2-ol (CAS 1020719-25-8) is a chemical compound with the molecular formula C24H26N2O4 and a molecular weight of 409.5 g/mol. IUPAC name: 1-(9H-carbazol-4-yloxy)-3-[2-[2-(trideuteriomethoxy)phenoxy]ethylamino]propan-2-ol. InChIKey: OGHNVEJMJSYVRP-FIBGUPNXSA-N.
| Molecular formula | C24H26N2O4 |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | 1-(9H-carbazol-4-yloxy)-3-[2-[2-(trideuteriomethoxy)phenoxy]ethylamino]propan-2-ol |
| InChIKey | OGHNVEJMJSYVRP-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC=C1OCCNCC(COC2=CC=CC3=C2C4=CC=CC=C4N3)O |
Computed by PubChem (NCBI)