Products 1133705-56-2
CAS 1133705-56-2 appears in our catalog under these names: (±)-Carvedilol-d4 (ethyl-d4), 99 atom % D, min 98% Chemical Purity, Carvedilol–d4, Carvedilol-d4, 99.80%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1mg, 1 mg, 5 mg.
1-(9H-carbazol-4-yloxy)-3-[[1,1,2,2-tetradeuterio-2-(2-methoxyphenoxy)ethyl]amino]propan-2-ol (CAS 1133705-56-2) is a chemical compound with the molecular formula C24H26N2O4 and a molecular weight of 410.5 g/mol. IUPAC name: 1-(9H-carbazol-4-yloxy)-3-[[1,1,2,2-tetradeuterio-2-(2-methoxyphenoxy)ethyl]amino]propan-2-ol. InChIKey: OGHNVEJMJSYVRP-RYIWKTDQSA-N.
| Molecular formula | C24H26N2O4 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | 1-(9H-carbazol-4-yloxy)-3-[[1,1,2,2-tetradeuterio-2-(2-methoxyphenoxy)ethyl]amino]propan-2-ol |
| InChIKey | OGHNVEJMJSYVRP-RYIWKTDQSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])OC1=CC=CC=C1OC)NCC(COC2=CC=CC3=C2C4=CC=CC=C4N3)O |
Computed by PubChem (NCBI)