Products 199657-47-1

CAS 199657-47-1 is the registry number for Givinostat Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.

4-[[6-(diethylaminomethyl)naphthalen-2-yl]methoxycarbonylamino]benzoic acid (CAS 199657-47-1) is a chemical compound with the molecular formula C24H26N2O4 and a molecular weight of 406.5 g/mol. IUPAC name: 4-[[6-(diethylaminomethyl)naphthalen-2-yl]methoxycarbonylamino]benzoic acid. InChIKey: NCHVNKHIEHGHEU-UHFFFAOYSA-N.

Identity
Molecular formulaC24H26N2O4
Molecular weight406.5 g/mol
IUPAC name4-[[6-(diethylaminomethyl)naphthalen-2-yl]methoxycarbonylamino]benzoic acid
InChIKeyNCHVNKHIEHGHEU-UHFFFAOYSA-N
SMILESCCN(CC)CC1=CC2=C(C=C1)C=C(C=C2)COC(=O)NC3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)