Products 929106-58-1
CAS 929106-58-1 appears in our catalog under these names: Carvedilol–d5, Carvedilol-d5, Carvedilol-d5, >95% (HPLC). Offered by: GLPBio, Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 1mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500μg.
1-(9H-carbazol-4-yloxy)-1,1,2,3,3-pentadeuterio-3-[2-(2-methoxyphenoxy)ethylamino]propan-2-ol (CAS 929106-58-1) is a chemical compound with the molecular formula C24H26N2O4 and a molecular weight of 411.5 g/mol. IUPAC name: 1-(9H-carbazol-4-yloxy)-1,1,2,3,3-pentadeuterio-3-[2-(2-methoxyphenoxy)ethylamino]propan-2-ol. InChIKey: OGHNVEJMJSYVRP-IZIHCQFESA-N.
| Molecular formula | C24H26N2O4 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | 1-(9H-carbazol-4-yloxy)-1,1,2,3,3-pentadeuterio-3-[2-(2-methoxyphenoxy)ethylamino]propan-2-ol |
| InChIKey | OGHNVEJMJSYVRP-IZIHCQFESA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC1=CC=CC2=C1C3=CC=CC=C3N2)O)NCCOC4=CC=CC=C4OC |
Computed by PubChem (NCBI)
Synonyms:
Carvedilol-d5, orb3138351