CAS 1062606-12-5 appears in our catalog under these names: (±)-Venlafaxine-d6 HCl (N,N-dimethyl-d6), 99 atom % D, min 98% Chemical Purity, (±)-Venlafaxine-d6 Hydrochloride (N,N-dimethyl-d6), >95% (HPLC), (±)-Venlafaxine-d6 HCl (N,N-dimethyl-d6), >95% (HPLC), Venlafaxine-D6 Hydrochloride 0.1 mg/ml in Methanol (as free base), Venlafaxine-D6.HCl. Offered by: CDN, TRC, LoGiCal, Lipomed, TargetMol. Available pack sizes: 0,05g, 0,005g, 0,5mg, 1mg, 5mg, 1ml, 50mg, 100mg.
1-[2-[bis(trideuteriomethyl)amino]-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol (CAS 1062606-12-5) is a chemical compound with the molecular formula C17H27NO2 and a molecular weight of 283.44 g/mol. IUPAC name: 1-[2-[bis(trideuteriomethyl)amino]-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol. InChIKey: PNVNVHUZROJLTJ-WFGJKAKNSA-N.
| Molecular formula | C17H27NO2 |
|---|---|
| Molecular weight | 283.44 g/mol |
| IUPAC name | 1-[2-[bis(trideuteriomethyl)amino]-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol |
| InChIKey | PNVNVHUZROJLTJ-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(CC(C1=CC=C(C=C1)OC)C2(CCCCC2)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)