CAS 102092-04-6 appears in our catalog under these names: Bis(2-chloroethyl)-d8-amine HCl, 98 atom % D, min 98% Chemical Purity, Bis(2-Chloroethyl)amine hydrochloride-d8. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg.
2-chloro-N-(2-chloro-1,1,2,2-tetradeuterioethyl)-1,1,2,2-tetradeuterioethanamine;hydrochloride (CAS 102092-04-6) is a chemical compound with the molecular formula C4H10Cl3N and a molecular weight of 186.53 g/mol. IUPAC name: 2-chloro-N-(2-chloro-1,1,2,2-tetradeuterioethyl)-1,1,2,2-tetradeuterioethanamine;hydrochloride. InChIKey: YMDZDFSUDFLGMX-PHHTYKMFSA-N.
| Molecular formula | C4H10Cl3N |
|---|---|
| Molecular weight | 186.53 g/mol |
| IUPAC name | 2-chloro-N-(2-chloro-1,1,2,2-tetradeuterioethyl)-1,1,2,2-tetradeuterioethanamine;hydrochloride |
| InChIKey | YMDZDFSUDFLGMX-PHHTYKMFSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])Cl)NC([2H])([2H])C([2H])([2H])Cl.Cl |
Computed by PubChem (NCBI)