Products 58880-33-4
CAS 58880-33-4 appears in our catalog under these names: Bis(2-chloroethyl)amine-d4 Hydrochloride, Bis(2-chloroethyl)amine-d4 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
2-chloro-N-(2-chloro-2,2-dideuterioethyl)-2,2-dideuterioethanamine;hydrochloride (CAS 58880-33-4) is a chemical compound with the molecular formula C4H10Cl3N and a molecular weight of 182.51 g/mol. IUPAC name: 2-chloro-N-(2-chloro-2,2-dideuterioethyl)-2,2-dideuterioethanamine;hydrochloride. InChIKey: YMDZDFSUDFLGMX-PBCJVBLFSA-N.
| Molecular formula | C4H10Cl3N |
|---|---|
| Molecular weight | 182.51 g/mol |
| IUPAC name | 2-chloro-N-(2-chloro-2,2-dideuterioethyl)-2,2-dideuterioethanamine;hydrochloride |
| InChIKey | YMDZDFSUDFLGMX-PBCJVBLFSA-N |
| SMILES | [2H]C([2H])(CNCC([2H])([2H])Cl)Cl.Cl |
Computed by PubChem (NCBI)