CAS 352431-06-2 appears in our catalog under these names: Bis(2–chloroethyl)amine–1,1,2,2–d4 hydrochloride, Bis(2-chloroethyl)amine-1,1,2,2-d4 (hydrochloride), 98.0%, Bis(2-chloroethyl)-1,1,2,2-d4-amine Hydrochloride, >95% (HPLC), Bis(2-chloroethyl)-1,1,2,2-d4-amine HCl, 98 atom % D, min 98% Chemical Purity. Offered by: GLPBio, MedChemExpress, TRC, CDN. Available pack sizes: 10mg, 25mg, 5mg, 10 mg, 5 mg, 25 mg, 100mg, 0,25g.
2-chloro-N-(2-chloroethyl)-1,1,2,2-tetradeuterioethanamine;hydrochloride (CAS 352431-06-2) is a chemical compound with the molecular formula C4H10Cl3N and a molecular weight of 182.51 g/mol. IUPAC name: 2-chloro-N-(2-chloroethyl)-1,1,2,2-tetradeuterioethanamine;hydrochloride. InChIKey: YMDZDFSUDFLGMX-HAFGEVJTSA-N.
| Molecular formula | C4H10Cl3N |
|---|---|
| Molecular weight | 182.51 g/mol |
| IUPAC name | 2-chloro-N-(2-chloroethyl)-1,1,2,2-tetradeuterioethanamine;hydrochloride |
| InChIKey | YMDZDFSUDFLGMX-HAFGEVJTSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])Cl)NCCCl.Cl |
Computed by PubChem (NCBI)