Products 1173018-36-4
CAS 1173018-36-4 is the registry number for Bis(2-chloroethyl)-13C4-amine Hydrochloride. Offered by: TRC. Available pack sizes: 50mg.
2-chloro-N-(2-chloro(1,2-13C2)ethyl)(1,2-13C2)ethanamine;hydrochloride (CAS 1173018-36-4) is a chemical compound with the molecular formula C4H10Cl3N and a molecular weight of 182.45 g/mol. IUPAC name: 2-chloro-N-(2-chloro(1,2-13C2)ethyl)(1,2-13C2)ethanamine;hydrochloride. InChIKey: YMDZDFSUDFLGMX-UJNKEPEOSA-N.
| Molecular formula | C4H10Cl3N |
|---|---|
| Molecular weight | 182.45 g/mol |
| IUPAC name | 2-chloro-N-(2-chloro(1,2-13C2)ethyl)(1,2-13C2)ethanamine;hydrochloride |
| InChIKey | YMDZDFSUDFLGMX-UJNKEPEOSA-N |
| SMILES | [13CH2]([13CH2]Cl)N[13CH2][13CH2]Cl.Cl |
Computed by PubChem (NCBI)