CAS 1020996-98-8 appears in our catalog under these names: 3-(4-(Propan-2-yl)phenyl)-1,2-oxazol-5-amine, 95%, 3-(4-(Propan-2-yl)phenyl)-1,2-oxazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-(4-propan-2-ylphenyl)-1,2-oxazol-5-amine (CAS 1020996-98-8) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: 3-(4-propan-2-ylphenyl)-1,2-oxazol-5-amine. InChIKey: UFKHVBQEQBOYAZ-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 3-(4-propan-2-ylphenyl)-1,2-oxazol-5-amine |
| InChIKey | UFKHVBQEQBOYAZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2=NOC(=C2)N |
Computed by PubChem (NCBI)