Products 1021077-51-9
CAS 1021077-51-9 is the registry number for 3-Chloro-6-(oxolan-2-ylmethoxy)pyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-chloro-6-(oxolan-2-ylmethoxy)pyridine-2-carboxylic acid (CAS 1021077-51-9) is a chemical compound with the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. IUPAC name: 3-chloro-6-(oxolan-2-ylmethoxy)pyridine-2-carboxylic acid. InChIKey: JHXUKUDPZWDTMB-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO4 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | 3-chloro-6-(oxolan-2-ylmethoxy)pyridine-2-carboxylic acid |
| InChIKey | JHXUKUDPZWDTMB-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)COC2=NC(=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)