CAS 1021143-01-0 appears in our catalog under these names: 2-(2-Bromo-4-methylphenoxy)pyridine-3-carbonitrile, 95%, 2-(2-Bromo-4-methylphenoxy)pyridine-3-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-(2-bromo-4-methylphenoxy)pyridine-3-carbonitrile (CAS 1021143-01-0) is a chemical compound with the molecular formula C13H9BrN2O and a molecular weight of 289.13 g/mol. IUPAC name: 2-(2-bromo-4-methylphenoxy)pyridine-3-carbonitrile. InChIKey: OSUWSVFZDVOKPM-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2O |
|---|---|
| Molecular weight | 289.13 g/mol |
| IUPAC name | 2-(2-bromo-4-methylphenoxy)pyridine-3-carbonitrile |
| InChIKey | OSUWSVFZDVOKPM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC2=C(C=CC=N2)C#N)Br |
Computed by PubChem (NCBI)