Products 949570-72-3
CAS 949570-72-3 appears in our catalog under these names: 11H-Dibenzo[b,e][1,4]diazepin-11-one, 2-bromo-5,10-dihydro-, 95%, 11H-dibenzo(b,e)(1,4)diazepin-11-one, 2-bromo-5,10-dihydro-, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
8-bromo-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (CAS 949570-72-3) is a chemical compound with the molecular formula C13H9BrN2O and a molecular weight of 289.13 g/mol. IUPAC name: 8-bromo-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one. InChIKey: BLBVMNPGEMTBBA-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2O |
|---|---|
| Molecular weight | 289.13 g/mol |
| IUPAC name | 8-bromo-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| InChIKey | BLBVMNPGEMTBBA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=C(C=C(C=C3)Br)C(=O)N2 |
Computed by PubChem (NCBI)