CAS 293737-81-2 is the registry number for 2-(3-Bromophenyl)-1,3-benzoxazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3-bromophenyl)-1,3-benzoxazol-5-amine (CAS 293737-81-2) is a chemical compound with the molecular formula C13H9BrN2O and a molecular weight of 289.13 g/mol. IUPAC name: 2-(3-bromophenyl)-1,3-benzoxazol-5-amine. InChIKey: RBEUAXOSGXEKQB-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2O |
|---|---|
| Molecular weight | 289.13 g/mol |
| IUPAC name | 2-(3-bromophenyl)-1,3-benzoxazol-5-amine |
| InChIKey | RBEUAXOSGXEKQB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NC3=C(O2)C=CC(=C3)N |
Computed by PubChem (NCBI)