CAS 755026-53-0 appears in our catalog under these names: 3-Bromo-5h-dibenzo[b,e][1,4]diazepin-11(10h)-one, 95%, 3-Bromo-5H-dibenzo(b,e)(1,4)diazepin-11(10H)-one, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
9-bromo-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (CAS 755026-53-0) is a chemical compound with the molecular formula C13H9BrN2O and a molecular weight of 289.13 g/mol. IUPAC name: 9-bromo-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one. InChIKey: MQKNIAACUFZSAW-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2O |
|---|---|
| Molecular weight | 289.13 g/mol |
| IUPAC name | 9-bromo-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| InChIKey | MQKNIAACUFZSAW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=C(C=CC(=C3)Br)C(=O)N2 |
Computed by PubChem (NCBI)