Products 1021166-43-7
CAS 1021166-43-7 is the registry number for Methyl 4,5-diamino-2,3-difluorobenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4,5-diamino-2,3-difluorobenzoate (CAS 1021166-43-7) is a chemical compound with the molecular formula C8H8F2N2O2 and a molecular weight of 202.16 g/mol. IUPAC name: methyl 4,5-diamino-2,3-difluorobenzoate. InChIKey: XESYTNQGDJIOKE-UHFFFAOYSA-N.
| Molecular formula | C8H8F2N2O2 |
|---|---|
| Molecular weight | 202.16 g/mol |
| IUPAC name | methyl 4,5-diamino-2,3-difluorobenzoate |
| InChIKey | XESYTNQGDJIOKE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1F)F)N)N |
Computed by PubChem (NCBI)