CAS 1248209-18-8 is the registry number for N-Ethyl-2,3-difluoro-6-nitroaniline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 5g, 1g.
N-ethyl-2,3-difluoro-6-nitroaniline (CAS 1248209-18-8) is a chemical compound with the molecular formula C8H8F2N2O2 and a molecular weight of 202.16 g/mol. IUPAC name: N-ethyl-2,3-difluoro-6-nitroaniline. InChIKey: OQZJPLHCMMMQOV-UHFFFAOYSA-N.
| Molecular formula | C8H8F2N2O2 |
|---|---|
| Molecular weight | 202.16 g/mol |
| IUPAC name | N-ethyl-2,3-difluoro-6-nitroaniline |
| InChIKey | OQZJPLHCMMMQOV-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C=CC(=C1F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)