CAS 333430-83-4 is the registry number for 2-(Difluoromethoxy)benzohydrazide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(difluoromethoxy)benzohydrazide (CAS 333430-83-4) is a chemical compound with the molecular formula C8H8F2N2O2 and a molecular weight of 202.16 g/mol. IUPAC name: 2-(difluoromethoxy)benzohydrazide. InChIKey: CLPIOLPQNRDLRV-UHFFFAOYSA-N.
| Molecular formula | C8H8F2N2O2 |
|---|---|
| Molecular weight | 202.16 g/mol |
| IUPAC name | 2-(difluoromethoxy)benzohydrazide |
| InChIKey | CLPIOLPQNRDLRV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NN)OC(F)F |
Computed by PubChem (NCBI)