CAS 1893586-21-4 is the registry number for [(2,2-Difluoro-2h-1,3-benzodioxol-5-yl)methyl]hydrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2,2-difluoro-1,3-benzodioxol-5-yl)methylhydrazine (CAS 1893586-21-4) is a chemical compound with the molecular formula C8H8F2N2O2 and a molecular weight of 202.16 g/mol. IUPAC name: (2,2-difluoro-1,3-benzodioxol-5-yl)methylhydrazine. InChIKey: SZOXDJWJYZMUED-UHFFFAOYSA-N.
| Molecular formula | C8H8F2N2O2 |
|---|---|
| Molecular weight | 202.16 g/mol |
| IUPAC name | (2,2-difluoro-1,3-benzodioxol-5-yl)methylhydrazine |
| InChIKey | SZOXDJWJYZMUED-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CNN)OC(O2)(F)F |
Computed by PubChem (NCBI)