Products 1021245-69-1
CAS 1021245-69-1 is the registry number for 3-(2-(Difluoromethoxy)phenyl)-1,2-oxazol-5-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-[2-(difluoromethoxy)phenyl]-1,2-oxazol-5-amine (CAS 1021245-69-1) is a chemical compound with the molecular formula C10H8F2N2O2 and a molecular weight of 226.18 g/mol. IUPAC name: 3-[2-(difluoromethoxy)phenyl]-1,2-oxazol-5-amine. InChIKey: CQNHDCIYMDBVMM-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N2O2 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | 3-[2-(difluoromethoxy)phenyl]-1,2-oxazol-5-amine |
| InChIKey | CQNHDCIYMDBVMM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=C2)N)OC(F)F |
Computed by PubChem (NCBI)