Products 1566076-86-5
CAS 1566076-86-5 is the registry number for Ethyl 4,5-difluoro-1H-benzo[d]imidazole-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4,5-difluoro-1H-benzimidazole-2-carboxylate (CAS 1566076-86-5) is a chemical compound with the molecular formula C10H8F2N2O2 and a molecular weight of 226.18 g/mol. IUPAC name: ethyl 4,5-difluoro-1H-benzimidazole-2-carboxylate. InChIKey: YENJTCCVMPDUTI-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N2O2 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | ethyl 4,5-difluoro-1H-benzimidazole-2-carboxylate |
| InChIKey | YENJTCCVMPDUTI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(N1)C=CC(=C2F)F |
Computed by PubChem (NCBI)