Products 2079948-90-4
CAS 2079948-90-4 is the registry number for Ethyl 2-(5-cyanopyridin-2-yl)-2,2-difluoroacetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(5-cyano-2-pyridinyl)-2,2-difluoroacetate (CAS 2079948-90-4) is a chemical compound with the molecular formula C10H8F2N2O2 and a molecular weight of 226.18 g/mol. IUPAC name: ethyl 2-(5-cyano-2-pyridinyl)-2,2-difluoroacetate. InChIKey: BYPMNFBHXFVCOJ-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N2O2 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | ethyl 2-(5-cyano-2-pyridinyl)-2,2-difluoroacetate |
| InChIKey | BYPMNFBHXFVCOJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=NC=C(C=C1)C#N)(F)F |
Computed by PubChem (NCBI)