Products 1052550-71-6
CAS 1052550-71-6 is the registry number for 5-(2,6-Difluorophenyl)-5-methylimidazolidine-2,4-dione, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-(2,6-difluorophenyl)-5-methylimidazolidine-2,4-dione (CAS 1052550-71-6) is a chemical compound with the molecular formula C10H8F2N2O2 and a molecular weight of 226.18 g/mol. IUPAC name: 5-(2,6-difluorophenyl)-5-methylimidazolidine-2,4-dione. InChIKey: WJVWKJADHBGWRG-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N2O2 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | 5-(2,6-difluorophenyl)-5-methylimidazolidine-2,4-dione |
| InChIKey | WJVWKJADHBGWRG-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=C(C=CC=C2F)F |
Computed by PubChem (NCBI)