CAS 1021245-84-0 appears in our catalog under these names: 3-(2,4-Difluorophenyl)isoxazol-5-amine, 95%, 3-(2,4-Difluorophenyl)-1,2-oxazol-5-amine, 3-(2,4-Difluorophenyl)-1,2-oxazol-5-amine, 95%, 95%, 3-(2,4-Difluorophenyl)-1,2-oxazol-5-amine, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 50mg, 0,5g, 100mg, 250mg, 500mg.
3-(2,4-difluorophenyl)-1,2-oxazol-5-amine (CAS 1021245-84-0) is a chemical compound with the molecular formula C9H6F2N2O and a molecular weight of 196.15 g/mol. IUPAC name: 3-(2,4-difluorophenyl)-1,2-oxazol-5-amine. InChIKey: IWLVIVKGGLGGEH-UHFFFAOYSA-N.
| Molecular formula | C9H6F2N2O |
|---|---|
| Molecular weight | 196.15 g/mol |
| IUPAC name | 3-(2,4-difluorophenyl)-1,2-oxazol-5-amine |
| InChIKey | IWLVIVKGGLGGEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=NOC(=C2)N |
Computed by PubChem (NCBI)