Products 1247452-55-6
CAS 1247452-55-6 is the registry number for 3-(2,3-difluorophenyl)isoxazol-5-amine, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-(2,3-difluorophenyl)-1,2-oxazol-5-amine (CAS 1247452-55-6) is a chemical compound with the molecular formula C9H6F2N2O and a molecular weight of 196.15 g/mol. IUPAC name: 3-(2,3-difluorophenyl)-1,2-oxazol-5-amine. InChIKey: LULMNWNWPJJTCU-UHFFFAOYSA-N.
| Molecular formula | C9H6F2N2O |
|---|---|
| Molecular weight | 196.15 g/mol |
| IUPAC name | 3-(2,3-difluorophenyl)-1,2-oxazol-5-amine |
| InChIKey | LULMNWNWPJJTCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C2=NOC(=C2)N |
Computed by PubChem (NCBI)