Products 1249863-38-4
CAS 1249863-38-4 is the registry number for 4-(2,6-Difluorophenyl)-1,3-oxazol-2-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(2,6-difluorophenyl)-1,3-oxazol-2-amine (CAS 1249863-38-4) is a chemical compound with the molecular formula C9H6F2N2O and a molecular weight of 196.15 g/mol. IUPAC name: 4-(2,6-difluorophenyl)-1,3-oxazol-2-amine. InChIKey: GYGSNWVLTVNIKK-UHFFFAOYSA-N.
| Molecular formula | C9H6F2N2O |
|---|---|
| Molecular weight | 196.15 g/mol |
| IUPAC name | 4-(2,6-difluorophenyl)-1,3-oxazol-2-amine |
| InChIKey | GYGSNWVLTVNIKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C2=COC(=N2)N)F |
Computed by PubChem (NCBI)