Products 1961-38-2
CAS 1961-38-2 is the registry number for 2-Cyano-N-(2,4-difluorophenyl)acetamide, 90%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
2-cyano-N-(2,4-difluorophenyl)acetamide (CAS 1961-38-2) is a chemical compound with the molecular formula C9H6F2N2O and a molecular weight of 196.15 g/mol. IUPAC name: 2-cyano-N-(2,4-difluorophenyl)acetamide. InChIKey: HRYUCAHUDHPLDZ-UHFFFAOYSA-N.
| Molecular formula | C9H6F2N2O |
|---|---|
| Molecular weight | 196.15 g/mol |
| IUPAC name | 2-cyano-N-(2,4-difluorophenyl)acetamide |
| InChIKey | HRYUCAHUDHPLDZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)NC(=O)CC#N |
Computed by PubChem (NCBI)