CAS 1021281-75-3 appears in our catalog under these names: N-(2-Methoxy-5-methylphenyl)-2-methyl-6-phenylpyrimidin-4-amine, 95%, N-(2-Methoxy-5-methylphenyl)-2-methyl-6-phenylpyrimidin-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
N-(2-methoxy-5-methylphenyl)-2-methyl-6-phenylpyrimidin-4-amine (CAS 1021281-75-3) is a chemical compound with the molecular formula C19H19N3O and a molecular weight of 305.4 g/mol. IUPAC name: N-(2-methoxy-5-methylphenyl)-2-methyl-6-phenylpyrimidin-4-amine. InChIKey: IRTUEWZTTNXNAB-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | N-(2-methoxy-5-methylphenyl)-2-methyl-6-phenylpyrimidin-4-amine |
| InChIKey | IRTUEWZTTNXNAB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC)NC2=NC(=NC(=C2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)