CAS 2242852-05-5 appears in our catalog under these names: Axitinib Impurity 33, Axitinib Impurity 30, Axitinib Tetrahydropyran. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
1-(oxan-2-yl)-3-[(E)-2-pyridin-2-ylethenyl]indazole (CAS 2242852-05-5) is a chemical compound with the molecular formula C19H19N3O and a molecular weight of 305.4 g/mol. IUPAC name: 1-(oxan-2-yl)-3-[(E)-2-pyridin-2-ylethenyl]indazole. InChIKey: XSZITJAOGFGRJU-VAWYXSNFSA-N.
| Molecular formula | C19H19N3O |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 1-(oxan-2-yl)-3-[(E)-2-pyridin-2-ylethenyl]indazole |
| InChIKey | XSZITJAOGFGRJU-VAWYXSNFSA-N |
| SMILES | C1CCOC(C1)N2C3=CC=CC=C3C(=N2)/C=C/C4=CC=CC=N4 |
Computed by PubChem (NCBI)