Products 170105-20-1
CAS 170105-20-1 appears in our catalog under these names: Imidafenacin Impurity 1, Imidafenacin Related Compound 1, Imidafenacin Impurity 11, Imidafenacin Impurity 2. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
4-imidazol-1-yl-2,2-diphenylbutanamide (CAS 170105-20-1) is a chemical compound with the molecular formula C19H19N3O and a molecular weight of 305.4 g/mol. IUPAC name: 4-imidazol-1-yl-2,2-diphenylbutanamide. InChIKey: NONWQRRLZPDXTD-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 4-imidazol-1-yl-2,2-diphenylbutanamide |
| InChIKey | NONWQRRLZPDXTD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCN2C=CN=C2)(C3=CC=CC=C3)C(=O)N |
Computed by PubChem (NCBI)