Products 865317-30-2
CAS 865317-30-2 appears in our catalog under these names: CDK5 inhibitor 20-223, CDK5 inhibitor 20–223, CDK5 inhibitor, CDK5 inhibitor 20-223, 99.62%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 50mg, 100mg, 10mg, 25mg, 5mg, 1mg, 10mM/1mL.
N-(5-cyclobutyl-1H-pyrazol-3-yl)-2-naphthalen-2-ylacetamide (CAS 865317-30-2) is a chemical compound with the molecular formula C19H19N3O and a molecular weight of 305.4 g/mol. IUPAC name: N-(5-cyclobutyl-1H-pyrazol-3-yl)-2-naphthalen-2-ylacetamide. InChIKey: AGVIDDQHAQSPIZ-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | N-(5-cyclobutyl-1H-pyrazol-3-yl)-2-naphthalen-2-ylacetamide |
| InChIKey | AGVIDDQHAQSPIZ-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=CC(=NN2)NC(=O)CC3=CC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)