CAS 1021425-36-4 is the registry number for 4-(1,1-Dioxido-4-thiomorpholinyl)-2-methoxybenzenamine. Offered by: TRC. Available pack sizes: 2,5g.
4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methoxyaniline (CAS 1021425-36-4) is a chemical compound with the molecular formula C11H16N2O3S and a molecular weight of 256.32 g/mol. IUPAC name: 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methoxyaniline. InChIKey: UEPJCFZDYMFNLN-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O3S |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methoxyaniline |
| InChIKey | UEPJCFZDYMFNLN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N2CCS(=O)(=O)CC2)N |
Computed by PubChem (NCBI)