CAS 102153-63-9 appears in our catalog under these names: 6-Chloro-2-naphthylsulfonylchloride 95%, 6-Chloro-2-naphthylsulfonylchloride, 95%, 95%, 6-Chloro-2-naphthylsulfonylchloride, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
6-chloronaphthalene-2-sulfonyl chloride (CAS 102153-63-9) is a chemical compound with the molecular formula C10H6Cl2O2S and a molecular weight of 261.12 g/mol. IUPAC name: 6-chloronaphthalene-2-sulfonyl chloride. InChIKey: IYFIYGSJZIICOZ-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2O2S |
|---|---|
| Molecular weight | 261.12 g/mol |
| IUPAC name | 6-chloronaphthalene-2-sulfonyl chloride |
| InChIKey | IYFIYGSJZIICOZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Cl)C=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)