CAS 75998-29-7 is the registry number for 3-Chloro-6-methoxy-1-benzothiophene-2-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-chloro-6-methoxy-1-benzothiophene-2-carbonyl chloride (CAS 75998-29-7) is a chemical compound with the molecular formula C10H6Cl2O2S and a molecular weight of 261.12 g/mol. IUPAC name: 3-chloro-6-methoxy-1-benzothiophene-2-carbonyl chloride. InChIKey: DTMXTCKEPQWRPO-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2O2S |
|---|---|
| Molecular weight | 261.12 g/mol |
| IUPAC name | 3-chloro-6-methoxy-1-benzothiophene-2-carbonyl chloride |
| InChIKey | DTMXTCKEPQWRPO-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=C(S2)C(=O)Cl)Cl |
Computed by PubChem (NCBI)